C2AuF6NO4S2 — CID 102109298
bis(trifluoromethylsulfonyl)azanide;gold(1+) (PubChem CID 102109298) has the molecular formula C2AuF6NO4S2 and a molecular weight of 477.11 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;gold(1+).
| Compound Name | bis(trifluoromethylsulfonyl)azanide;gold(1+) |
|---|---|
| PubChem CID | 102109298 |
| Molecular Formula | C2AuF6NO4S2 |
| Molecular Weight | 477.11 g/mol |
| Exact Mass | 476.88 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;gold(1+) |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Au+] |
| InChI | InChI=1S/C2F6NO4S2.Au/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q-1;+1 |
| InChIKey | KJZPGOSRTBCGKY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.11 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |