C8H3F11N2O4S2 — CID 162364627
bis(trifluoromethylsulfonyl)azanide;(2,3,4,5,6-pentafluorophenyl)azanium (PubChem CID 162364627) has the molecular formula C8H3F11N2O4S2 and a molecular weight of 464.23 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;(2,3,4,5,6-pentafluorophenyl)azanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;(2,3,4,5,6-pentafluorophenyl)azanium |
|---|---|
| PubChem CID | 162364627 |
| Molecular Formula | C8H3F11N2O4S2 |
| Molecular Weight | 464.23 g/mol |
| Exact Mass | 463.94 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;(2,3,4,5,6-pentafluorophenyl)azanium |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[NH3+]c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6H2F5N.C2F6NO4S2/c7-1-2(8)4(10)6(12)5(11)3(1)9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h12H2;/q;-1/p+1 |
| InChIKey | PJDMHSGXOQBGLE-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|