C8H16F6N2O4S2 — CID 11014427
bis(trifluoromethylsulfonyl)azanide;triethylazanium (PubChem CID 11014427) has the molecular formula C8H16F6N2O4S2 and a molecular weight of 382.35 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;triethylazanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;triethylazanium |
|---|---|
| PubChem CID | 11014427 |
| Molecular Formula | C8H16F6N2O4S2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H15N.C2F6NO4S2/c1-4-7(5-2)6-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-6H2,1-3H3;/q;-1/p+1 |
| InChIKey | OBXOFYJLFMBVRA-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |