C18H36F6NO4PS2 — CID 158388046
bis(trifluoromethylsulfonyl)azanide;tetrabutylphosphanium (PubChem CID 158388046) has the molecular formula C18H36F6NO4PS2 and a molecular weight of 539.59 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;tetrabutylphosphanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;tetrabutylphosphanium |
|---|---|
| PubChem CID | 158388046 |
| Molecular Formula | C18H36F6NO4PS2 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H36P.C2F6NO4S2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-16H2,1-4H3;/q+1;-1 |
| InChIKey | VJLXYWPNTKVSLC-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|