C23H36F12N3O8PS4 — CID 162021253
bis(bis(trifluoromethylsulfonyl)azanide);tripropyl(5-pyridin-1-ium-1-ylpentyl)phosphanium (PubChem CID 162021253) has the molecular formula C23H36F12N3O8PS4 and a molecular weight of 869.77 g/mol. Its IUPAC name is bis(bis(trifluoromethylsulfonyl)azanide);tripropyl(5-pyridin-1-ium-1-ylpentyl)phosphanium.
| Compound Name | bis(bis(trifluoromethylsulfonyl)azanide);tripropyl(5-pyridin-1-ium-1-ylpentyl)phosphanium |
|---|---|
| PubChem CID | 162021253 |
| Molecular Formula | C23H36F12N3O8PS4 |
| Molecular Weight | 869.77 g/mol |
| Exact Mass | 869.09 |
| IUPAC Name | bis(bis(trifluoromethylsulfonyl)azanide);tripropyl(5-pyridin-1-ium-1-ylpentyl)phosphanium |
| SMILES | CCC[P+](CCC)(CCC)CCCCC[n+]1ccccc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H36NP.2C2F6NO4S2/c1-4-16-21(17-5-2,18-6-3)19-12-8-11-15-20-13-9-7-10-14-20;2*3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7,9-10,13-14H,4-6,8,11-12,15-19H2,1-3H3;;/q+2;2*-1 |
| InChIKey | YUTXAZACAUPKPS-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 168.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.77 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|