C13H16F6N2O4S2 — CID 142678504
bis(trifluoromethylsulfonyl)azanide;1-butyl-4-ethenylpyridin-1-ium (PubChem CID 142678504) has the molecular formula C13H16F6N2O4S2 and a molecular weight of 442.40 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-butyl-4-ethenylpyridin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-butyl-4-ethenylpyridin-1-ium |
|---|---|
| PubChem CID | 142678504 |
| Molecular Formula | C13H16F6N2O4S2 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-butyl-4-ethenylpyridin-1-ium |
| SMILES | C=Cc1cc[n+](CCCC)cc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H16N.C2F6NO4S2/c1-3-5-8-12-9-6-11(4-2)7-10-12;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4,6-7,9-10H,2-3,5,8H2,1H3;/q+1;-1 |
| InChIKey | QTDBRTOFNQJLBX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|