C11H15NO3S — CID 146220302
4-(4-ethenylpyridin-1-ium-1-yl)butane-1-sulfonate (PubChem CID 146220302) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 4-(4-ethenylpyridin-1-ium-1-yl)butane-1-sulfonate.
| Compound Name | 4-(4-ethenylpyridin-1-ium-1-yl)butane-1-sulfonate |
|---|---|
| PubChem CID | 146220302 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 4-(4-ethenylpyridin-1-ium-1-yl)butane-1-sulfonate |
| SMILES | C=Cc1cc[n+](CCCCS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H15NO3S/c1-2-11-5-8-12(9-6-11)7-3-4-10-16(13,14)15/h2,5-6,8-9H,1,3-4,7,10H2 |
| InChIKey | IKTSQMRISHFQJR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|