C19H20F3NO3S — CID 20716923
4-[4-[(E)-2-[4-methyl-2-(trifluoromethyl)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonate (PubChem CID 20716923) has the molecular formula C19H20F3NO3S and a molecular weight of 399.43 g/mol. Its IUPAC name is 4-[4-[(E)-2-[4-methyl-2-(trifluoromethyl)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[4-[(E)-2-[4-methyl-2-(trifluoromethyl)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 20716923 |
| Molecular Formula | C19H20F3NO3S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 4-[4-[(E)-2-[4-methyl-2-(trifluoromethyl)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonate |
| SMILES | Cc1ccc(/C=C/c2cc[n+](CCCCS(=O)(=O)[O-])cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3NO3S/c1-15-4-6-17(18(14-15)19(20,21)22)7-5-16-8-11-23(12-9-16)10-2-3-13-27(24,25)26/h4-9,11-12,14H,2-3,10,13H2,1H3/b7-5+ |
| InChIKey | ZVANCUFVBGDQJQ-FNORWQNLSA-N |
| XLogP | 3.80 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|