C19H25N2O4S+ — CID 21344053
4-[4-[(E)-2-[4-[ethyl(hydroxy)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 21344053) has the molecular formula C19H25N2O4S+ and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[4-[(E)-2-[4-[ethyl(hydroxy)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[4-[(E)-2-[4-[ethyl(hydroxy)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 21344053 |
| Molecular Formula | C19H25N2O4S+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-[4-[(E)-2-[4-[ethyl(hydroxy)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CCN(O)c1ccc(/C=C/c2cc[n+](CCCCS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-2-21(22)19-9-7-17(8-10-19)5-6-18-11-14-20(15-12-18)13-3-4-16-26(23,24)25/h5-12,14-15H,2-4,13,16H2,1H3,(H-,22,23,24,25)/p+1 |
| InChIKey | ITGZRAKFVJSFPE-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|