C21H29N2+ — CID 122579493
4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]-N,N-diethylaniline (PubChem CID 122579493) has the molecular formula C21H29N2+ and a molecular weight of 309.48 g/mol. Its IUPAC name is 4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 122579493 |
| Molecular Formula | C21H29N2+ |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]-N,N-diethylaniline |
| SMILES | CCCC[n+]1ccc(/C=C/c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C21H29N2/c1-4-7-16-22-17-14-20(15-18-22)9-8-19-10-12-21(13-11-19)23(5-2)6-3/h8-15,17-18H,4-7,16H2,1-3H3/q+1 |
| InChIKey | DYDBHDWWVUNFGK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|