C42H58N4 — CID 158421229
carbanide;4-[(E)-2-[1-[6-[4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]ethenyl]-N,N-diethylaniline (PubChem CID 158421229) has the molecular formula C42H58N4 and a molecular weight of 618.95 g/mol. Its IUPAC name is carbanide;4-[(E)-2-[1-[6-[4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]ethenyl]-N,N-diethylaniline.
| Compound Name | carbanide;4-[(E)-2-[1-[6-[4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 158421229 |
| Molecular Formula | C42H58N4 |
| Molecular Weight | 618.95 g/mol |
| Exact Mass | 618.47 |
| IUPAC Name | carbanide;4-[(E)-2-[1-[6-[4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexyl]pyridin-1-ium-4-yl]ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=C/c2cc[n+](CCCCCC[n+]3ccc(/C=C/c4ccc(N(CC)CC)cc4)cc3)cc2)cc1.[CH3-].[CH3-] |
| InChI | InChI=1S/C40H52N4.2CH3/c1-5-43(6-2)39-21-17-35(18-22-39)13-15-37-25-31-41(32-26-37)29-11-9-10-12-30-42-33-27-38(28-34-42)16-14-36-19-23-40(24-20-36)44(7-3)8-4;;/h13-28,31-34H,5-12,29-30H2,1-4H3;2*1H3/q+2;2*-1 |
| InChIKey | HAMYROLXJZVMBN-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.95 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|