C38H48N4O+2 — CID 75984107
4-[2-[1-[2-[2-[4-[2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]ethoxy]ethyl]pyridin-1-ium-4-yl]ethenyl]-N,N-diethylaniline (PubChem CID 75984107) has the molecular formula C38H48N4O+2 and a molecular weight of 576.83 g/mol. Its IUPAC name is 4-[2-[1-[2-[2-[4-[2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]ethoxy]ethyl]pyridin-1-ium-4-yl]ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[2-[1-[2-[2-[4-[2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]ethoxy]ethyl]pyridin-1-ium-4-yl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 75984107 |
| Molecular Formula | C38H48N4O+2 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 4-[2-[1-[2-[2-[4-[2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]ethoxy]ethyl]pyridin-1-ium-4-yl]ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C=Cc2cc[n+](CCOCC[n+]3ccc(C=Cc4ccc(N(CC)CC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H48N4O/c1-5-41(6-2)37-17-13-33(14-18-37)9-11-35-21-25-39(26-22-35)29-31-43-32-30-40-27-23-36(24-28-40)12-10-34-15-19-38(20-16-34)42(7-3)8-4/h9-28H,5-8,29-32H2,1-4H3/q+2 |
| InChIKey | QFKFXHIKYKPMOM-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|