C23H29N2+ — CID 177390544
N,N-diethyl-4-[(1E,3E,5E)-6-(1-ethylpyridin-1-ium-4-yl)hexa-1,3,5-trienyl]aniline (PubChem CID 177390544) has the molecular formula C23H29N2+ and a molecular weight of 333.50 g/mol. Its IUPAC name is N,N-diethyl-4-[(1E,3E,5E)-6-(1-ethylpyridin-1-ium-4-yl)hexa-1,3,5-trienyl]aniline.
| Compound Name | N,N-diethyl-4-[(1E,3E,5E)-6-(1-ethylpyridin-1-ium-4-yl)hexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 177390544 |
| Molecular Formula | C23H29N2+ |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N,N-diethyl-4-[(1E,3E,5E)-6-(1-ethylpyridin-1-ium-4-yl)hexa-1,3,5-trienyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=C/C=C/C=C/c2cc[n+](CC)cc2)cc1 |
| InChI | InChI=1S/C23H29N2/c1-4-24-19-17-22(18-20-24)12-10-8-7-9-11-21-13-15-23(16-14-21)25(5-2)6-3/h7-20H,4-6H2,1-3H3/q+1 |
| InChIKey | PWJANDIOBXBHMB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|