C42H51N3 — CID 57028933
4-[2-[3,5-bis[2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diethylaniline (PubChem CID 57028933) has the molecular formula C42H51N3 and a molecular weight of 597.89 g/mol. Its IUPAC name is 4-[2-[3,5-bis[2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[2-[3,5-bis[2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 57028933 |
| Molecular Formula | C42H51N3 |
| Molecular Weight | 597.89 g/mol |
| Exact Mass | 597.41 |
| IUPAC Name | 4-[2-[3,5-bis[2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C=Cc2cc(C=Cc3ccc(N(CC)CC)cc3)cc(C=Cc3ccc(N(CC)CC)cc3)c2)cc1 |
| InChI | InChI=1S/C42H51N3/c1-7-43(8-2)40-25-19-34(20-26-40)13-16-37-31-38(17-14-35-21-27-41(28-22-35)44(9-3)10-4)33-39(32-37)18-15-36-23-29-42(30-24-36)45(11-5)12-6/h13-33H,7-12H2,1-6H3 |
| InChIKey | MRCVTBVDURJKBQ-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.89 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|