C17H22N4 — CID 86173463
4-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)ethenyl]-N,N-diethylaniline (PubChem CID 86173463) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 86173463 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C=Cc2nc(C)nc(C)n2)cc1 |
| InChI | InChI=1S/C17H22N4/c1-5-21(6-2)16-10-7-15(8-11-16)9-12-17-19-13(3)18-14(4)20-17/h7-12H,5-6H2,1-4H3 |
| InChIKey | SRPGNJDYSFDUGG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|