C30H36N2 — CID 102038782
4-[(E)-2-[3-[(E)-2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diethylaniline (PubChem CID 102038782) has the molecular formula C30H36N2 and a molecular weight of 424.63 g/mol. Its IUPAC name is 4-[(E)-2-[3-[(E)-2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(E)-2-[3-[(E)-2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 102038782 |
| Molecular Formula | C30H36N2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | 4-[(E)-2-[3-[(E)-2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=C/c2cccc(/C=C/c3ccc(N(CC)CC)cc3)c2)cc1 |
| InChI | InChI=1S/C30H36N2/c1-5-31(6-2)29-20-16-25(17-21-29)12-14-27-10-9-11-28(24-27)15-13-26-18-22-30(23-19-26)32(7-3)8-4/h9-24H,5-8H2,1-4H3/b14-12+,15-13+ |
| InChIKey | VVCXWWDJXSDRDL-QUMQEAAQSA-N |
| XLogP | 7.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|