C43H46N2P+ — CID 102301120
4-[(E)-2-[2-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-5-methyl-5-phenylbenzo[b]phosphindol-5-ium-8-yl]ethenyl]-N,N-diethylaniline (PubChem CID 102301120) has the molecular formula C43H46N2P+ and a molecular weight of 621.83 g/mol. Its IUPAC name is 4-[(E)-2-[2-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-5-methyl-5-phenylbenzo[b]phosphindol-5-ium-8-yl]ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(E)-2-[2-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-5-methyl-5-phenylbenzo[b]phosphindol-5-ium-8-yl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 102301120 |
| Molecular Formula | C43H46N2P+ |
| Molecular Weight | 621.83 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | 4-[(E)-2-[2-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-5-methyl-5-phenylbenzo[b]phosphindol-5-ium-8-yl]ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=C/c2ccc3c(c2)-c2cc(/C=C/c4ccc(N(CC)CC)cc4)ccc2[P+]3(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H46N2P/c1-6-44(7-2)37-25-19-33(20-26-37)15-17-35-23-29-42-40(31-35)41-32-36(18-16-34-21-27-38(28-22-34)45(8-3)9-4)24-30-43(41)46(42,5)39-13-11-10-12-14-39/h10-32H,6-9H2,1-5H3/q+1/b17-15+,18-16+ |
| InChIKey | YVOJLBIJHSCFCE-YTEMWHBBSA-N |
| XLogP | 9.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.83 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|