C38H44N2Si — CID 101499417
4-[(E)-2-[2-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-5,5-dimethylbenzo[b][1]benzosilol-8-yl]ethenyl]-N,N-diethylaniline (PubChem CID 101499417) has the molecular formula C38H44N2Si and a molecular weight of 556.87 g/mol. Its IUPAC name is 4-[(E)-2-[2-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-5,5-dimethylbenzo[b][1]benzosilol-8-yl]ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(E)-2-[2-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-5,5-dimethylbenzo[b][1]benzosilol-8-yl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 101499417 |
| Molecular Formula | C38H44N2Si |
| Molecular Weight | 556.87 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | 4-[(E)-2-[2-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-5,5-dimethylbenzo[b][1]benzosilol-8-yl]ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=C/c2ccc3c(c2)-c2cc(/C=C/c4ccc(N(CC)CC)cc4)ccc2[Si]3(C)C)cc1 |
| InChI | InChI=1S/C38H44N2Si/c1-7-39(8-2)33-21-15-29(16-22-33)11-13-31-19-25-37-35(27-31)36-28-32(20-26-38(36)41(37,5)6)14-12-30-17-23-34(24-18-30)40(9-3)10-4/h11-28H,7-10H2,1-6H3/b13-11+,14-12+ |
| InChIKey | HKNWPVVVTOVAQU-PHEQNACWSA-N |
| XLogP | 8.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.87 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|