C20H25N — CID 139552946
4-[(E)-2-(3,4-dimethylphenyl)ethenyl]-N,N-diethylaniline (PubChem CID 139552946) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 4-[(E)-2-(3,4-dimethylphenyl)ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(E)-2-(3,4-dimethylphenyl)ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 139552946 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 4-[(E)-2-(3,4-dimethylphenyl)ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=C/c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C20H25N/c1-5-21(6-2)20-13-11-18(12-14-20)9-10-19-8-7-16(3)17(4)15-19/h7-15H,5-6H2,1-4H3/b10-9+ |
| InChIKey | IEDOAAVQSQVCEO-MDZDMXLPSA-N |
| XLogP | 5.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|