C43H47N3 — CID 59989534
1-N,1-N,3-N,3-N-tetraethyl-4-[2-[4-(4-methyl-N-[4-(2-phenylethenyl)phenyl]anilino)phenyl]ethenyl]benzene-1,3-diamine (PubChem CID 59989534) has the molecular formula C43H47N3 and a molecular weight of 605.87 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetraethyl-4-[2-[4-(4-methyl-N-[4-(2-phenylethenyl)phenyl]anilino)phenyl]ethenyl]benzene-1,3-diamine.
| Compound Name | 1-N,1-N,3-N,3-N-tetraethyl-4-[2-[4-(4-methyl-N-[4-(2-phenylethenyl)phenyl]anilino)phenyl]ethenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 59989534 |
| Molecular Formula | C43H47N3 |
| Molecular Weight | 605.87 g/mol |
| Exact Mass | 605.38 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetraethyl-4-[2-[4-(4-methyl-N-[4-(2-phenylethenyl)phenyl]anilino)phenyl]ethenyl]benzene-1,3-diamine |
| SMILES | CCN(CC)c1ccc(C=Cc2ccc(N(c3ccc(C)cc3)c3ccc(C=Cc4ccccc4)cc3)cc2)c(N(CC)CC)c1 |
| InChI | InChI=1S/C43H47N3/c1-6-44(7-2)42-32-25-38(43(33-42)45(8-3)9-4)24-19-37-22-30-41(31-23-37)46(39-26-15-34(5)16-27-39)40-28-20-36(21-29-40)18-17-35-13-11-10-12-14-35/h10-33H,6-9H2,1-5H3 |
| InChIKey | JZTHQXDOUWRSAW-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.87 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|