C58H48N2 — CID 121368155
1-N,3-N-bis(4-methylphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1-N,3-N-bis[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3-diamine (PubChem CID 121368155) has the molecular formula C58H48N2 and a molecular weight of 773.04 g/mol. Its IUPAC name is 1-N,3-N-bis(4-methylphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1-N,3-N-bis[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis(4-methylphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1-N,3-N-bis[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 121368155 |
| Molecular Formula | C58H48N2 |
| Molecular Weight | 773.04 g/mol |
| Exact Mass | 772.38 |
| IUPAC Name | 1-N,3-N-bis(4-methylphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1-N,3-N-bis[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3-diamine |
| SMILES | Cc1ccc(N(c2ccc(/C=C/c3ccccc3)cc2)c2ccc(/C=C/C=C/c3ccccc3)c(N(c3ccc(C)cc3)c3ccc(/C=C/c4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C58H48N2/c1-45-22-35-53(36-23-45)59(54-39-30-50(31-40-54)28-26-48-16-8-4-9-17-48)57-43-34-52(21-13-12-20-47-14-6-3-7-15-47)58(44-57)60(55-37-24-46(2)25-38-55)56-41-32-51(33-42-56)29-27-49-18-10-5-11-19-49/h3-44H,1-2H3/b20-12+,21-13+,28-26+,29-27+ |
| InChIKey | RXJRNAQYVUZUKX-JLQMUSSFSA-N |
| XLogP | 16.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.04 |
| LogP ≤ 5 | 16.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|