C48H43N — CID 123769354
2,5-dimethyl-N-[4-[(1E)-8-phenylocta-1,3,5,7-tetraenyl]phenyl]-N-[4-(8-phenylocta-1,3,5,7-tetraenyl)phenyl]aniline (PubChem CID 123769354) has the molecular formula C48H43N and a molecular weight of 633.88 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-[(1E)-8-phenylocta-1,3,5,7-tetraenyl]phenyl]-N-[4-(8-phenylocta-1,3,5,7-tetraenyl)phenyl]aniline.
| Compound Name | 2,5-dimethyl-N-[4-[(1E)-8-phenylocta-1,3,5,7-tetraenyl]phenyl]-N-[4-(8-phenylocta-1,3,5,7-tetraenyl)phenyl]aniline |
|---|---|
| PubChem CID | 123769354 |
| Molecular Formula | C48H43N |
| Molecular Weight | 633.88 g/mol |
| Exact Mass | 633.34 |
| IUPAC Name | 2,5-dimethyl-N-[4-[(1E)-8-phenylocta-1,3,5,7-tetraenyl]phenyl]-N-[4-(8-phenylocta-1,3,5,7-tetraenyl)phenyl]aniline |
| SMILES | Cc1ccc(C)c(N(c2ccc(C=CC=CC=CC=Cc3ccccc3)cc2)c2ccc(/C=C/C=CC=CC=Cc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C48H43N/c1-40-29-30-41(2)48(39-40)49(46-35-31-44(32-36-46)27-15-9-5-3-7-13-21-42-23-17-11-18-24-42)47-37-33-45(34-38-47)28-16-10-6-4-8-14-22-43-25-19-12-20-26-43/h3-39H,1-2H3/b7-3?,8-4?,9-5?,10-6?,21-13?,22-14?,27-15+,28-16? |
| InChIKey | RQRUNRIAOOZWNL-BVKKGCSRSA-N |
| XLogP | 13.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.88 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|