C50H43N5 — CID 118601843
N,N-bis[4-[(E,3E)-3-(diphenylhydrazinylidene)prop-1-enyl]phenyl]-2,4-dimethylaniline (PubChem CID 118601843) has the molecular formula C50H43N5 and a molecular weight of 713.93 g/mol. Its IUPAC name is N,N-bis[4-[(E,3E)-3-(diphenylhydrazinylidene)prop-1-enyl]phenyl]-2,4-dimethylaniline.
| Compound Name | N,N-bis[4-[(E,3E)-3-(diphenylhydrazinylidene)prop-1-enyl]phenyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 118601843 |
| Molecular Formula | C50H43N5 |
| Molecular Weight | 713.93 g/mol |
| Exact Mass | 713.35 |
| IUPAC Name | N,N-bis[4-[(E,3E)-3-(diphenylhydrazinylidene)prop-1-enyl]phenyl]-2,4-dimethylaniline |
| SMILES | Cc1ccc(N(c2ccc(/C=C/C=N/N(c3ccccc3)c3ccccc3)cc2)c2ccc(/C=C/C=N/N(c3ccccc3)c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C50H43N5/c1-40-27-36-50(41(2)39-40)53(44-32-28-42(29-33-44)17-15-37-51-54(46-19-7-3-8-20-46)47-21-9-4-10-22-47)45-34-30-43(31-35-45)18-16-38-52-55(48-23-11-5-12-24-48)49-25-13-6-14-26-49/h3-39H,1-2H3/b17-15+,18-16+,51-37+,52-38+ |
| InChIKey | MDBGGCNWCFFSQH-MOLLHOHMSA-N |
| XLogP | 13.45 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.93 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|