C54H43N5 — CID 118601846
N,N-bis[4-[(E,3E)-3-(diphenylhydrazinylidene)prop-1-enyl]phenyl]-2-phenylaniline (PubChem CID 118601846) has the molecular formula C54H43N5 and a molecular weight of 761.97 g/mol. Its IUPAC name is N,N-bis[4-[(E,3E)-3-(diphenylhydrazinylidene)prop-1-enyl]phenyl]-2-phenylaniline.
| Compound Name | N,N-bis[4-[(E,3E)-3-(diphenylhydrazinylidene)prop-1-enyl]phenyl]-2-phenylaniline |
|---|---|
| PubChem CID | 118601846 |
| Molecular Formula | C54H43N5 |
| Molecular Weight | 761.97 g/mol |
| Exact Mass | 761.35 |
| IUPAC Name | N,N-bis[4-[(E,3E)-3-(diphenylhydrazinylidene)prop-1-enyl]phenyl]-2-phenylaniline |
| SMILES | C(=C/c1ccc(N(c2ccc(/C=C/C=N/N(c3ccccc3)c3ccccc3)cc2)c2ccccc2-c2ccccc2)cc1)\C=N\N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H43N5/c1-6-22-46(23-7-1)53-32-16-17-33-54(53)57(47-38-34-44(35-39-47)20-18-42-55-58(49-24-8-2-9-25-49)50-26-10-3-11-27-50)48-40-36-45(37-41-48)21-19-43-56-59(51-28-12-4-13-29-51)52-30-14-5-15-31-52/h1-43H/b20-18+,21-19+,55-42+,56-43+ |
| InChIKey | QGDZVRPWYOVJHP-LQLYPUTISA-N |
| XLogP | 14.50 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.97 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|