C48H36N2 — CID 163689663
2,3,5,6-tetradeuterio-N,N-diphenyl-4-[2,3,5,6-tetradeuterio-4-[2,3,5,6-tetradeuterio-4-(N-(2-phenylphenyl)anilino)phenyl]phenyl]aniline (PubChem CID 163689663) has the molecular formula C48H36N2 and a molecular weight of 652.90 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N,N-diphenyl-4-[2,3,5,6-tetradeuterio-4-[2,3,5,6-tetradeuterio-4-(N-(2-phenylphenyl)anilino)phenyl]phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N,N-diphenyl-4-[2,3,5,6-tetradeuterio-4-[2,3,5,6-tetradeuterio-4-(N-(2-phenylphenyl)anilino)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 163689663 |
| Molecular Formula | C48H36N2 |
| Molecular Weight | 652.90 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N,N-diphenyl-4-[2,3,5,6-tetradeuterio-4-[2,3,5,6-tetradeuterio-4-(N-(2-phenylphenyl)anilino)phenyl]phenyl]aniline |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c(N(c3ccccc3)c3ccccc3-c3ccccc3)c([2H])c2[2H])c([2H])c([2H])c1-c1c([2H])c([2H])c(N(c2ccccc2)c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H36N2/c1-5-15-41(16-6-1)47-23-13-14-24-48(47)50(44-21-11-4-12-22-44)46-35-31-40(32-36-46)38-27-25-37(26-28-38)39-29-33-45(34-30-39)49(42-17-7-2-8-18-42)43-19-9-3-10-20-43/h1-36H/i25D,26D,27D,28D,29D,30D,31D,32D,33D,34D,35D,36D |
| InChIKey | XFPCWZJYYHGGKR-NSHMTLHOSA-N |
| XLogP | 13.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.90 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |