C57H48N2 — CID 58883902
9,9-dimethyl-2-N,7-N-bis(4-methylphenyl)-2-N,7-N-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene-2,7-diamine (PubChem CID 58883902) has the molecular formula C57H48N2 and a molecular weight of 761.03 g/mol. Its IUPAC name is 9,9-dimethyl-2-N,7-N-bis(4-methylphenyl)-2-N,7-N-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene-2,7-diamine.
| Compound Name | 9,9-dimethyl-2-N,7-N-bis(4-methylphenyl)-2-N,7-N-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene-2,7-diamine |
|---|---|
| PubChem CID | 58883902 |
| Molecular Formula | C57H48N2 |
| Molecular Weight | 761.03 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | 9,9-dimethyl-2-N,7-N-bis(4-methylphenyl)-2-N,7-N-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene-2,7-diamine |
| SMILES | Cc1ccc(N(c2ccc(/C=C/c3ccccc3)cc2)c2ccc3c(c2)C(C)(C)c2cc(N(c4ccc(C)cc4)c4ccc(/C=C/c5ccccc5)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C57H48N2/c1-41-15-27-47(28-16-41)58(49-31-23-45(24-32-49)21-19-43-11-7-5-8-12-43)51-35-37-53-54-38-36-52(40-56(54)57(3,4)55(53)39-51)59(48-29-17-42(2)18-30-48)50-33-25-46(26-34-50)22-20-44-13-9-6-10-14-44/h5-40H,1-4H3/b21-19+,22-20+ |
| InChIKey | PMALGYQNVZRESN-FLFKKZLDSA-N |
| XLogP | 15.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.03 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|