C73H60N2 — CID 58883844
2-N,7-N-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-2-N,7-N-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene-2,7-diamine (PubChem CID 58883844) has the molecular formula C73H60N2 and a molecular weight of 965.30 g/mol. Its IUPAC name is 2-N,7-N-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-2-N,7-N-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-2-N,7-N-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene-2,7-diamine |
|---|---|
| PubChem CID | 58883844 |
| Molecular Formula | C73H60N2 |
| Molecular Weight | 965.30 g/mol |
| Exact Mass | 964.48 |
| IUPAC Name | 2-N,7-N-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-2-N,7-N-bis[4-[(E)-2-phenylethenyl]phenyl]fluorene-2,7-diamine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(/C=C/c4ccccc4)cc3)c3ccc4c(c3)C(C)(C)c3cc(N(c5ccc(/C=C/c6ccccc6)cc5)c5ccc6c(c5)C(C)(C)c5ccccc5-6)ccc3-4)cc21 |
| InChI | InChI=1S/C73H60N2/c1-71(2)65-23-15-13-21-59(65)61-41-37-55(45-67(61)71)74(53-33-29-51(30-34-53)27-25-49-17-9-7-10-18-49)57-39-43-63-64-44-40-58(48-70(64)73(5,6)69(63)47-57)75(54-35-31-52(32-36-54)28-26-50-19-11-8-12-20-50)56-38-42-62-60-22-14-16-24-66(60)72(3,4)68(62)46-56/h7-48H,1-6H3/b27-25+,28-26+ |
| InChIKey | FNCWNOFHOBZKPT-NBHCHVEOSA-N |
| XLogP | 19.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.30 |
| LogP ≤ 5 | 19.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|