C55H46N2 — CID 89067791
N-(3,5-dimethylphenyl)-9,9-dimethyl-N-[4-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]phenyl]fluoren-2-amine (PubChem CID 89067791) has the molecular formula C55H46N2 and a molecular weight of 734.99 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-9,9-dimethyl-N-[4-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]phenyl]fluoren-2-amine.
| Compound Name | N-(3,5-dimethylphenyl)-9,9-dimethyl-N-[4-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 89067791 |
| Molecular Formula | C55H46N2 |
| Molecular Weight | 734.99 g/mol |
| Exact Mass | 734.37 |
| IUPAC Name | N-(3,5-dimethylphenyl)-9,9-dimethyl-N-[4-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]phenyl]fluoren-2-amine |
| SMILES | Cc1cc(C)cc(N(c2ccc(-c3ccc(/C=C/c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)cc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)c1 |
| InChI | InChI=1S/C55H46N2/c1-39-35-40(2)37-50(36-39)57(49-33-34-52-51-17-11-12-18-53(51)55(3,4)54(52)38-49)48-31-27-44(28-32-48)43-25-21-41(22-26-43)19-20-42-23-29-47(30-24-42)56(45-13-7-5-8-14-45)46-15-9-6-10-16-46/h5-38H,1-4H3/b20-19+ |
| InChIKey | HYAVHMWKBAOTLK-FMQUCBEESA-N |
| XLogP | 15.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.99 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|