C63H52N2 — CID 89068180
7-[(E)-2-[9,9-dimethyl-7-(4-methyl-N-(4-phenylphenyl)anilino)fluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine (PubChem CID 89068180) has the molecular formula C63H52N2 and a molecular weight of 837.12 g/mol. Its IUPAC name is 7-[(E)-2-[9,9-dimethyl-7-(4-methyl-N-(4-phenylphenyl)anilino)fluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-[(E)-2-[9,9-dimethyl-7-(4-methyl-N-(4-phenylphenyl)anilino)fluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 89068180 |
| Molecular Formula | C63H52N2 |
| Molecular Weight | 837.12 g/mol |
| Exact Mass | 836.41 |
| IUPAC Name | 7-[(E)-2-[9,9-dimethyl-7-(4-methyl-N-(4-phenylphenyl)anilino)fluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
| SMILES | Cc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc3c(c2)C(C)(C)c2cc(/C=C/c4ccc5c(c4)C(C)(C)c4cc(N(c6ccccc6)c6ccccc6)ccc4-5)ccc2-3)cc1 |
| InChI | InChI=1S/C63H52N2/c1-43-21-29-50(30-22-43)65(51-31-27-47(28-32-51)46-15-9-6-10-16-46)53-34-38-57-55-36-26-45(40-59(55)63(4,5)61(57)42-53)24-23-44-25-35-54-56-37-33-52(41-60(56)62(2,3)58(54)39-44)64(48-17-11-7-12-18-48)49-19-13-8-14-20-49/h6-42H,1-5H3/b24-23+ |
| InChIKey | JNFGCSPZGYAIEJ-WCWDXBQESA-N |
| XLogP | 17.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.12 |
| LogP ≤ 5 | 17.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|