C58H50N2 — CID 90878487
7-[2-[9,9-dimethyl-7-(3-methyl-N-(3-methylphenyl)anilino)fluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine (PubChem CID 90878487) has the molecular formula C58H50N2 and a molecular weight of 775.05 g/mol. Its IUPAC name is 7-[2-[9,9-dimethyl-7-(3-methyl-N-(3-methylphenyl)anilino)fluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-[2-[9,9-dimethyl-7-(3-methyl-N-(3-methylphenyl)anilino)fluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 90878487 |
| Molecular Formula | C58H50N2 |
| Molecular Weight | 775.05 g/mol |
| Exact Mass | 774.40 |
| IUPAC Name | 7-[2-[9,9-dimethyl-7-(3-methyl-N-(3-methylphenyl)anilino)fluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
| SMILES | Cc1cccc(N(c2cccc(C)c2)c2ccc3c(c2)C(C)(C)c2cc(C=Cc4ccc5c(c4)C(C)(C)c4cc(N(c6ccccc6)c6ccccc6)ccc4-5)ccc2-3)c1 |
| InChI | InChI=1S/C58H50N2/c1-39-15-13-21-45(33-39)60(46-22-14-16-40(2)34-46)48-28-32-52-50-30-26-42(36-54(50)58(5,6)56(52)38-48)24-23-41-25-29-49-51-31-27-47(37-55(51)57(3,4)53(49)35-41)59(43-17-9-7-10-18-43)44-19-11-8-12-20-44/h7-38H,1-6H3 |
| InChIKey | XVIPXTPEMVCJJH-UHFFFAOYSA-N |
| XLogP | 16.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.05 |
| LogP ≤ 5 | 16.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|