C61H56N2 — CID 89068171
7-[(E)-2-[7-(N-(4-tert-butylphenyl)-4-methylanilino)-9,9-dimethylfluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine (PubChem CID 89068171) has the molecular formula C61H56N2 and a molecular weight of 817.13 g/mol. Its IUPAC name is 7-[(E)-2-[7-(N-(4-tert-butylphenyl)-4-methylanilino)-9,9-dimethylfluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-[(E)-2-[7-(N-(4-tert-butylphenyl)-4-methylanilino)-9,9-dimethylfluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 89068171 |
| Molecular Formula | C61H56N2 |
| Molecular Weight | 817.13 g/mol |
| Exact Mass | 816.44 |
| IUPAC Name | 7-[(E)-2-[7-(N-(4-tert-butylphenyl)-4-methylanilino)-9,9-dimethylfluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
| SMILES | Cc1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)C(C)(C)c2cc(/C=C/c4ccc5c(c4)C(C)(C)c4cc(N(c6ccccc6)c6ccccc6)ccc4-5)ccc2-3)cc1 |
| InChI | InChI=1S/C61H56N2/c1-41-19-27-47(28-20-41)63(48-29-25-44(26-30-48)59(2,3)4)50-32-36-54-52-34-24-43(38-56(52)61(7,8)58(54)40-50)22-21-42-23-33-51-53-35-31-49(39-57(53)60(5,6)55(51)37-42)62(45-15-11-9-12-16-45)46-17-13-10-14-18-46/h9-40H,1-8H3/b22-21+ |
| InChIKey | VJAUDBWJUFPDKH-QURGRASLSA-N |
| XLogP | 17.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.13 |
| LogP ≤ 5 | 17.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|