C52H48N2 — CID 89067561
7-[(E)-2-[4-(N-(4-tert-butylphenyl)-4-methylanilino)phenyl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine (PubChem CID 89067561) has the molecular formula C52H48N2 and a molecular weight of 700.97 g/mol. Its IUPAC name is 7-[(E)-2-[4-(N-(4-tert-butylphenyl)-4-methylanilino)phenyl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-[(E)-2-[4-(N-(4-tert-butylphenyl)-4-methylanilino)phenyl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 89067561 |
| Molecular Formula | C52H48N2 |
| Molecular Weight | 700.97 g/mol |
| Exact Mass | 700.38 |
| IUPAC Name | 7-[(E)-2-[4-(N-(4-tert-butylphenyl)-4-methylanilino)phenyl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
| SMILES | Cc1ccc(N(c2ccc(/C=C/c3ccc4c(c3)C(C)(C)c3cc(N(c5ccccc5)c5ccccc5)ccc3-4)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C52H48N2/c1-37-17-26-43(27-18-37)53(45-30-24-40(25-31-45)51(2,3)4)44-28-21-38(22-29-44)19-20-39-23-33-47-48-34-32-46(36-50(48)52(5,6)49(47)35-39)54(41-13-9-7-10-14-41)42-15-11-8-12-16-42/h7-36H,1-6H3/b20-19+ |
| InChIKey | CEUZFJLBMYUBEO-FMQUCBEESA-N |
| XLogP | 14.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.97 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|