C64H56N2 — CID 89074720
7-[(E)-2-[7-(4-tert-butyl-N-naphthalen-2-ylanilino)-9,9-dimethylfluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine (PubChem CID 89074720) has the molecular formula C64H56N2 and a molecular weight of 853.17 g/mol. Its IUPAC name is 7-[(E)-2-[7-(4-tert-butyl-N-naphthalen-2-ylanilino)-9,9-dimethylfluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-[(E)-2-[7-(4-tert-butyl-N-naphthalen-2-ylanilino)-9,9-dimethylfluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 89074720 |
| Molecular Formula | C64H56N2 |
| Molecular Weight | 853.17 g/mol |
| Exact Mass | 852.44 |
| IUPAC Name | 7-[(E)-2-[7-(4-tert-butyl-N-naphthalen-2-ylanilino)-9,9-dimethylfluoren-2-yl]ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc3c(c2)C(C)(C)c2cc(/C=C/c4ccc5c(c4)C(C)(C)c4cc(N(c6ccccc6)c6ccccc6)ccc4-5)ccc2-3)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C64H56N2/c1-62(2,3)47-27-30-50(31-28-47)66(51-29-26-45-16-14-15-17-46(45)40-51)53-33-37-57-55-35-25-44(39-59(55)64(6,7)61(57)42-53)23-22-43-24-34-54-56-36-32-52(41-60(56)63(4,5)58(54)38-43)65(48-18-10-8-11-19-48)49-20-12-9-13-21-49/h8-42H,1-7H3/b23-22+ |
| InChIKey | VHPBXVPSRIIVSP-GHVJWSGMSA-N |
| XLogP | 17.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.17 |
| LogP ≤ 5 | 17.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|