C53H44N2 — CID 89067686
N-(3,5-dimethylphenyl)-9,9-dimethyl-N-naphthalen-2-yl-7-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine (PubChem CID 89067686) has the molecular formula C53H44N2 and a molecular weight of 708.95 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-9,9-dimethyl-N-naphthalen-2-yl-7-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine.
| Compound Name | N-(3,5-dimethylphenyl)-9,9-dimethyl-N-naphthalen-2-yl-7-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 89067686 |
| Molecular Formula | C53H44N2 |
| Molecular Weight | 708.95 g/mol |
| Exact Mass | 708.35 |
| IUPAC Name | N-(3,5-dimethylphenyl)-9,9-dimethyl-N-naphthalen-2-yl-7-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine |
| SMILES | Cc1cc(C)cc(N(c2ccc3c(c2)C(C)(C)c2cc(/C=C/c4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc2-3)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C53H44N2/c1-37-31-38(2)33-48(32-37)55(46-27-24-41-13-11-12-14-42(41)35-46)47-28-30-50-49-29-23-40(34-51(49)53(3,4)52(50)36-47)20-19-39-21-25-45(26-22-39)54(43-15-7-5-8-16-43)44-17-9-6-10-18-44/h5-36H,1-4H3/b20-19+ |
| InChIKey | XRSKJTQBLWKIDP-FMQUCBEESA-N |
| XLogP | 14.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.95 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|