C50H44N2 — CID 91484997
N-(3,5-dimethylphenyl)-9,9-dimethyl-N-(3-methylphenyl)-7-[2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine (PubChem CID 91484997) has the molecular formula C50H44N2 and a molecular weight of 672.92 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-9,9-dimethyl-N-(3-methylphenyl)-7-[2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine.
| Compound Name | N-(3,5-dimethylphenyl)-9,9-dimethyl-N-(3-methylphenyl)-7-[2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 91484997 |
| Molecular Formula | C50H44N2 |
| Molecular Weight | 672.92 g/mol |
| Exact Mass | 672.35 |
| IUPAC Name | N-(3,5-dimethylphenyl)-9,9-dimethyl-N-(3-methylphenyl)-7-[2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine |
| SMILES | Cc1cccc(N(c2cc(C)cc(C)c2)c2ccc3c(c2)C(C)(C)c2cc(C=Cc4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc2-3)c1 |
| InChI | InChI=1S/C50H44N2/c1-35-13-12-18-43(30-35)52(45-31-36(2)29-37(3)32-45)44-26-28-47-46-27-23-39(33-48(46)50(4,5)49(47)34-44)20-19-38-21-24-42(25-22-38)51(40-14-8-6-9-15-40)41-16-10-7-11-17-41/h6-34H,1-5H3 |
| InChIKey | RQJPBIGTEHMVKA-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.92 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|