C57H48N2 — CID 90693832
N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-(3-methylphenyl)-7-[2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine (PubChem CID 90693832) has the molecular formula C57H48N2 and a molecular weight of 761.03 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-(3-methylphenyl)-7-[2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-(3-methylphenyl)-7-[2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 90693832 |
| Molecular Formula | C57H48N2 |
| Molecular Weight | 761.03 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-(3-methylphenyl)-7-[2-[4-(N-phenylanilino)phenyl]ethenyl]fluoren-2-amine |
| SMILES | Cc1cccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccc3c(c2)C(C)(C)c2cc(C=Cc4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc2-3)c1 |
| InChI | InChI=1S/C57H48N2/c1-39-15-14-20-45(35-39)59(46-30-33-50-48-21-12-13-22-52(48)56(2,3)54(50)37-46)47-31-34-51-49-32-27-41(36-53(49)57(4,5)55(51)38-47)24-23-40-25-28-44(29-26-40)58(42-16-8-6-9-17-42)43-18-10-7-11-19-43/h6-38H,1-5H3 |
| InChIKey | YXFBHNYPLBWDAN-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.03 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|