C37H31NO — CID 58098593
4-[bis(9,9-dimethylfluoren-2-yl)amino]benzaldehyde (PubChem CID 58098593) has the molecular formula C37H31NO and a molecular weight of 505.66 g/mol. Its IUPAC name is 4-[bis(9,9-dimethylfluoren-2-yl)amino]benzaldehyde.
| Compound Name | 4-[bis(9,9-dimethylfluoren-2-yl)amino]benzaldehyde |
|---|---|
| PubChem CID | 58098593 |
| Molecular Formula | C37H31NO |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 4-[bis(9,9-dimethylfluoren-2-yl)amino]benzaldehyde |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(C=O)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C37H31NO/c1-36(2)32-11-7-5-9-28(32)30-19-17-26(21-34(30)36)38(25-15-13-24(23-39)14-16-25)27-18-20-31-29-10-6-8-12-33(29)37(3,4)35(31)22-27/h5-23H,1-4H3 |
| InChIKey | KSRHKOLSOXXCAT-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|