C16H19NS — CID 101038849
N,N-diethyl-4-[(E)-2-thiophen-2-ylethenyl]aniline (PubChem CID 101038849) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-2-thiophen-2-ylethenyl]aniline.
| Compound Name | N,N-diethyl-4-[(E)-2-thiophen-2-ylethenyl]aniline |
|---|---|
| PubChem CID | 101038849 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N,N-diethyl-4-[(E)-2-thiophen-2-ylethenyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C16H19NS/c1-3-17(4-2)15-10-7-14(8-11-15)9-12-16-6-5-13-18-16/h5-13H,3-4H2,1-2H3/b12-9+ |
| InChIKey | MOUJAZAKDAEEDW-FMIVXFBMSA-N |
| XLogP | 4.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|