C32H25NS — CID 20603581
N,N-diphenyl-3-[(E)-2-[4-[(E)-2-thiophen-2-ylethenyl]phenyl]ethenyl]aniline (PubChem CID 20603581) has the molecular formula C32H25NS and a molecular weight of 455.63 g/mol. Its IUPAC name is N,N-diphenyl-3-[(E)-2-[4-[(E)-2-thiophen-2-ylethenyl]phenyl]ethenyl]aniline.
| Compound Name | N,N-diphenyl-3-[(E)-2-[4-[(E)-2-thiophen-2-ylethenyl]phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 20603581 |
| Molecular Formula | C32H25NS |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N,N-diphenyl-3-[(E)-2-[4-[(E)-2-thiophen-2-ylethenyl]phenyl]ethenyl]aniline |
| SMILES | C(=C/c1cccc(N(c2ccccc2)c2ccccc2)c1)\c1ccc(/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C32H25NS/c1-3-10-29(11-4-1)33(30-12-5-2-6-13-30)31-14-7-9-28(25-31)21-20-26-16-18-27(19-17-26)22-23-32-15-8-24-34-32/h1-25H/b21-20+,23-22+ |
| InChIKey | OMPFHGMLXCLRRI-RLJRJAJVSA-N |
| XLogP | 9.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|