C34H29NO2S — CID 20603543
3-methoxy-4-[(E)-2-[3-methoxy-4-[(E)-2-thiophen-2-ylethenyl]phenyl]ethenyl]-N,N-diphenylaniline (PubChem CID 20603543) has the molecular formula C34H29NO2S and a molecular weight of 515.68 g/mol. Its IUPAC name is 3-methoxy-4-[(E)-2-[3-methoxy-4-[(E)-2-thiophen-2-ylethenyl]phenyl]ethenyl]-N,N-diphenylaniline.
| Compound Name | 3-methoxy-4-[(E)-2-[3-methoxy-4-[(E)-2-thiophen-2-ylethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 20603543 |
| Molecular Formula | C34H29NO2S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 3-methoxy-4-[(E)-2-[3-methoxy-4-[(E)-2-thiophen-2-ylethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
| SMILES | COc1cc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2OC)ccc1/C=C/c1cccs1 |
| InChI | InChI=1S/C34H29NO2S/c1-36-33-24-26(16-18-28(33)20-22-32-14-9-23-38-32)15-17-27-19-21-31(25-34(27)37-2)35(29-10-5-3-6-11-29)30-12-7-4-8-13-30/h3-25H,1-2H3/b17-15+,22-20+ |
| InChIKey | AKOVFCGEHWYQCX-ICGGPLBBSA-N |
| XLogP | 9.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|