C36H29Cl2NO2 — CID 59055952
4-[2-[2,5-dichloro-4-[2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]-N-(4-methoxyphenyl)-N-phenylaniline (PubChem CID 59055952) has the molecular formula C36H29Cl2NO2 and a molecular weight of 578.54 g/mol. Its IUPAC name is 4-[2-[2,5-dichloro-4-[2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]-N-(4-methoxyphenyl)-N-phenylaniline.
| Compound Name | 4-[2-[2,5-dichloro-4-[2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]-N-(4-methoxyphenyl)-N-phenylaniline |
|---|---|
| PubChem CID | 59055952 |
| Molecular Formula | C36H29Cl2NO2 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | 4-[2-[2,5-dichloro-4-[2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]-N-(4-methoxyphenyl)-N-phenylaniline |
| SMILES | COc1ccc(C=Cc2cc(Cl)c(C=Cc3ccc(N(c4ccccc4)c4ccc(OC)cc4)cc3)cc2Cl)cc1 |
| InChI | InChI=1S/C36H29Cl2NO2/c1-40-33-20-12-27(13-21-33)9-15-29-25-35(37)28(24-36(29)38)14-8-26-10-16-31(17-11-26)39(30-6-4-3-5-7-30)32-18-22-34(41-2)23-19-32/h3-25H,1-2H3 |
| InChIKey | CRRUVMDVOABBGY-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|