C30H29NO — CID 14766504
N-(4-methoxyphenyl)-N-phenyl-4-[(E)-2-(2,4,5-trimethylphenyl)ethenyl]aniline (PubChem CID 14766504) has the molecular formula C30H29NO and a molecular weight of 419.57 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-phenyl-4-[(E)-2-(2,4,5-trimethylphenyl)ethenyl]aniline.
| Compound Name | N-(4-methoxyphenyl)-N-phenyl-4-[(E)-2-(2,4,5-trimethylphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 14766504 |
| Molecular Formula | C30H29NO |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-(4-methoxyphenyl)-N-phenyl-4-[(E)-2-(2,4,5-trimethylphenyl)ethenyl]aniline |
| SMILES | COc1ccc(N(c2ccccc2)c2ccc(/C=C/c3cc(C)c(C)cc3C)cc2)cc1 |
| InChI | InChI=1S/C30H29NO/c1-22-20-24(3)26(21-23(22)2)13-10-25-11-14-28(15-12-25)31(27-8-6-5-7-9-27)29-16-18-30(32-4)19-17-29/h5-21H,1-4H3/b13-10+ |
| InChIKey | WVMIMFSCHQHFIG-JLHYYAGUSA-N |
| XLogP | 8.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|