C68H52N2O2 — CID 88888023
4-[(E)-2-[9,10-bis(4-methoxyphenyl)-6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenanthren-3-yl]ethenyl]-N,N-diphenylaniline (PubChem CID 88888023) has the molecular formula C68H52N2O2 and a molecular weight of 929.18 g/mol. Its IUPAC name is 4-[(E)-2-[9,10-bis(4-methoxyphenyl)-6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenanthren-3-yl]ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(E)-2-[9,10-bis(4-methoxyphenyl)-6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenanthren-3-yl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 88888023 |
| Molecular Formula | C68H52N2O2 |
| Molecular Weight | 929.18 g/mol |
| Exact Mass | 928.40 |
| IUPAC Name | 4-[(E)-2-[9,10-bis(4-methoxyphenyl)-6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenanthren-3-yl]ethenyl]-N,N-diphenylaniline |
| SMILES | COc1ccc(-c2c(-c3ccc(OC)cc3)c3ccc(/C=C/c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3c3cc(/C=C/c4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc23)cc1 |
| InChI | InChI=1S/C68H52N2O2/c1-71-61-41-33-53(34-42-61)67-63-45-31-51(25-23-49-27-37-59(38-28-49)69(55-15-7-3-8-16-55)56-17-9-4-10-18-56)47-65(63)66-48-52(32-46-64(66)68(67)54-35-43-62(72-2)44-36-54)26-24-50-29-39-60(40-30-50)70(57-19-11-5-12-20-57)58-21-13-6-14-22-58/h3-48H,1-2H3/b25-23+,26-24+ |
| InChIKey | WORFLVFFYSEHAS-OGGGYYITSA-N |
| XLogP | 18.62 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.18 |
| LogP ≤ 5 | 18.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|