C54H40N4O2 — CID 11297254
2,6-bis[(E)-2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1,5-dicarbonitrile (PubChem CID 11297254) has the molecular formula C54H40N4O2 and a molecular weight of 776.94 g/mol. Its IUPAC name is 2,6-bis[(E)-2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1,5-dicarbonitrile.
| Compound Name | 2,6-bis[(E)-2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 11297254 |
| Molecular Formula | C54H40N4O2 |
| Molecular Weight | 776.94 g/mol |
| Exact Mass | 776.32 |
| IUPAC Name | 2,6-bis[(E)-2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1,5-dicarbonitrile |
| SMILES | COc1ccc(N(c2ccccc2)c2ccc(/C=C/c3ccc4c(C#N)c(/C=C/c5ccc(N(c6ccccc6)c6ccc(OC)cc6)cc5)ccc4c3C#N)cc2)cc1 |
| InChI | InChI=1S/C54H40N4O2/c1-59-49-31-27-47(28-32-49)57(43-9-5-3-6-10-43)45-23-15-39(16-24-45)13-19-41-21-35-52-51(53(41)37-55)36-22-42(54(52)38-56)20-14-40-17-25-46(26-18-40)58(44-11-7-4-8-12-44)48-29-33-50(60-2)34-30-48/h3-36H,1-2H3/b19-13+,20-14+ |
| InChIKey | VMVVUCDMRGRWPZ-IWGRKNQJSA-N |
| XLogP | 13.88 |
| TPSA | 72.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.94 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|