C58H42N4 — CID 89372299
2,6-bis[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracene-9,10-dicarbonitrile (PubChem CID 89372299) has the molecular formula C58H42N4 and a molecular weight of 795.00 g/mol. Its IUPAC name is 2,6-bis[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracene-9,10-dicarbonitrile.
| Compound Name | 2,6-bis[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracene-9,10-dicarbonitrile |
|---|---|
| PubChem CID | 89372299 |
| Molecular Formula | C58H42N4 |
| Molecular Weight | 795.00 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | 2,6-bis[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracene-9,10-dicarbonitrile |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(C=Cc3ccc4c(C#N)c5cc(C=Cc6ccc(N(c7ccccc7)c7ccc(C)cc7)cc6)ccc5c(C#N)c4c3)cc2)cc1 |
| InChI | InChI=1S/C58H42N4/c1-41-13-27-49(28-14-41)61(47-9-5-3-6-10-47)51-31-21-43(22-32-51)17-19-45-25-35-53-55(37-45)57(39-59)54-36-26-46(38-56(54)58(53)40-60)20-18-44-23-33-52(34-24-44)62(48-11-7-4-8-12-48)50-29-15-42(2)16-30-50/h3-38H,1-2H3 |
| InChIKey | UYEKPVGNBMVLBO-UHFFFAOYSA-N |
| XLogP | 15.63 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.00 |
| LogP ≤ 5 | 15.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|