C50H34N4 — CID 143438518
3-[(E)-2-(N-phenylanilino)ethenyl]-6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenanthrene-9,10-dicarbonitrile (PubChem CID 143438518) has the molecular formula C50H34N4 and a molecular weight of 690.85 g/mol. Its IUPAC name is 3-[(E)-2-(N-phenylanilino)ethenyl]-6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenanthrene-9,10-dicarbonitrile.
| Compound Name | 3-[(E)-2-(N-phenylanilino)ethenyl]-6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenanthrene-9,10-dicarbonitrile |
|---|---|
| PubChem CID | 143438518 |
| Molecular Formula | C50H34N4 |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 3-[(E)-2-(N-phenylanilino)ethenyl]-6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenanthrene-9,10-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c2ccc(/C=C/N(c3ccccc3)c3ccccc3)cc2c2cc(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)ccc12 |
| InChI | InChI=1S/C50H34N4/c51-35-49-45-29-25-38(22-21-37-23-27-44(28-24-37)54(42-17-9-3-10-18-42)43-19-11-4-12-20-43)33-47(45)48-34-39(26-30-46(48)50(49)36-52)31-32-53(40-13-5-1-6-14-40)41-15-7-2-8-16-41/h1-34H/b22-21+,32-31+ |
| InChIKey | ZLNQUBVBZPDCLO-JDKSXPNOSA-N |
| XLogP | 13.19 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|