C21H16N2 — CID 21439549
(E)-3-[4-(N-phenylanilino)phenyl]prop-2-enenitrile (PubChem CID 21439549) has the molecular formula C21H16N2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (E)-3-[4-(N-phenylanilino)phenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-(N-phenylanilino)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 21439549 |
| Molecular Formula | C21H16N2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (E)-3-[4-(N-phenylanilino)phenyl]prop-2-enenitrile |
| SMILES | N#C/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16N2/c22-17-7-8-18-13-15-21(16-14-18)23(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-16H/b8-7+ |
| InChIKey | LMCBSDUNSKMNTO-BQYQJAHWSA-N |
| XLogP | 5.69 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|