C58H42F6N2 — CID 152845856
4-methyl-N-[4-[(Z)-2-[6-[(E)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-9,10-bis(trifluoromethyl)phenanthren-3-yl]ethenyl]phenyl]-N-phenylaniline (PubChem CID 152845856) has the molecular formula C58H42F6N2 and a molecular weight of 880.98 g/mol. Its IUPAC name is 4-methyl-N-[4-[(Z)-2-[6-[(E)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-9,10-bis(trifluoromethyl)phenanthren-3-yl]ethenyl]phenyl]-N-phenylaniline.
| Compound Name | 4-methyl-N-[4-[(Z)-2-[6-[(E)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-9,10-bis(trifluoromethyl)phenanthren-3-yl]ethenyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 152845856 |
| Molecular Formula | C58H42F6N2 |
| Molecular Weight | 880.98 g/mol |
| Exact Mass | 880.33 |
| IUPAC Name | 4-methyl-N-[4-[(Z)-2-[6-[(E)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-9,10-bis(trifluoromethyl)phenanthren-3-yl]ethenyl]phenyl]-N-phenylaniline |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(/C=C\c3ccc4c(C(F)(F)F)c(C(F)(F)F)c5ccc(/C=C/c6ccc(N(c7ccccc7)c7ccc(C)cc7)cc6)cc5c4c3)cc2)cc1 |
| InChI | InChI=1S/C58H42F6N2/c1-39-13-27-47(28-14-39)65(45-9-5-3-6-10-45)49-31-21-41(22-32-49)17-19-43-25-35-51-53(37-43)54-38-44(26-36-52(54)56(58(62,63)64)55(51)57(59,60)61)20-18-42-23-33-50(34-24-42)66(46-11-7-4-8-12-46)48-29-15-40(2)16-30-48/h3-38H,1-2H3/b19-17-,20-18+ |
| InChIKey | TUALFQCBKASAFO-YAFCTCPESA-N |
| XLogP | 17.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.98 |
| LogP ≤ 5 | 17.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|