C60H46N4 — CID 23576513
10-isocyano-2,6-bis[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracene-9-carbonitrile (PubChem CID 23576513) has the molecular formula C60H46N4 and a molecular weight of 823.06 g/mol. Its IUPAC name is 10-isocyano-2,6-bis[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracene-9-carbonitrile.
| Compound Name | 10-isocyano-2,6-bis[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracene-9-carbonitrile |
|---|---|
| PubChem CID | 23576513 |
| Molecular Formula | C60H46N4 |
| Molecular Weight | 823.06 g/mol |
| Exact Mass | 822.37 |
| IUPAC Name | 10-isocyano-2,6-bis[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracene-9-carbonitrile |
| SMILES | [C-]#[N+]c1c2ccc(/C=C/c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2c(C#N)c2ccc(/C=C/c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc12 |
| InChI | InChI=1S/C60H46N4/c1-41-6-24-49(25-7-41)63(50-26-8-42(2)9-27-50)53-32-18-45(19-33-53)14-16-47-23-37-56-57(38-47)59(40-61)55-36-22-48(39-58(55)60(56)62-5)17-15-46-20-34-54(35-21-46)64(51-28-10-43(3)11-29-51)52-30-12-44(4)13-31-52/h6-39H,1-4H3/b16-14+,17-15+ |
| InChIKey | LQOIFYDRUWAAKH-YXLFCKQPSA-N |
| XLogP | 16.93 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.06 |
| LogP ≤ 5 | 16.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|