C56H44N4O4 — CID 18338881
5-isocyano-2,6-bis[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1-carbonitrile (PubChem CID 18338881) has the molecular formula C56H44N4O4 and a molecular weight of 836.99 g/mol. Its IUPAC name is 5-isocyano-2,6-bis[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1-carbonitrile.
| Compound Name | 5-isocyano-2,6-bis[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 18338881 |
| Molecular Formula | C56H44N4O4 |
| Molecular Weight | 836.99 g/mol |
| Exact Mass | 836.34 |
| IUPAC Name | 5-isocyano-2,6-bis[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1-carbonitrile |
| SMILES | [C-]#[N+]c1c(/C=C/c2ccc(N(c3ccc(OC)cc3)c3ccc(OC)cc3)cc2)ccc2c(C#N)c(/C=C/c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)ccc12 |
| InChI | InChI=1S/C56H44N4O4/c1-58-56-42(13-7-40-10-18-44(19-11-40)60(47-24-32-51(63-4)33-25-47)48-26-34-52(64-5)35-27-48)15-36-53-54(56)37-14-41(55(53)38-57)12-6-39-8-16-43(17-9-39)59(45-20-28-49(61-2)29-21-45)46-22-30-50(62-3)31-23-46/h6-37H,2-5H3/b12-6+,13-7+ |
| InChIKey | VPJDBKVQWOONHP-PWHKKFIBSA-N |
| XLogP | 14.58 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.99 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|